C12H21NO — CID 162758455
(3-ethyl-3,5,5-trimethylcyclohexyl) cyanate (PubChem CID 162758455) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3-ethyl-3,5,5-trimethylcyclohexyl) cyanate.
| Compound Name | (3-ethyl-3,5,5-trimethylcyclohexyl) cyanate |
|---|---|
| PubChem CID | 162758455 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3-ethyl-3,5,5-trimethylcyclohexyl) cyanate |
| SMILES | CCC1(C)CC(OC#N)CC(C)(C)C1 |
| InChI | InChI=1S/C12H21NO/c1-5-12(4)7-10(14-9-13)6-11(2,3)8-12/h10H,5-8H2,1-4H3 |
| InChIKey | APAVBRJTXLKQAI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|