C14H25NO — CID 162758456
[3,3,5-trimethyl-5-(2-methylpropyl)cyclohexyl] cyanate (PubChem CID 162758456) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is [3,3,5-trimethyl-5-(2-methylpropyl)cyclohexyl] cyanate.
| Compound Name | [3,3,5-trimethyl-5-(2-methylpropyl)cyclohexyl] cyanate |
|---|---|
| PubChem CID | 162758456 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | [3,3,5-trimethyl-5-(2-methylpropyl)cyclohexyl] cyanate |
| SMILES | CC(C)CC1(C)CC(OC#N)CC(C)(C)C1 |
| InChI | InChI=1S/C14H25NO/c1-11(2)6-14(5)8-12(16-10-15)7-13(3,4)9-14/h11-12H,6-9H2,1-5H3 |
| InChIKey | NREPENIUEXZZHS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|