C13H23NO2 — CID 153361069
[3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate (PubChem CID 153361069) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate.
| Compound Name | [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate |
|---|---|
| PubChem CID | 153361069 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate |
| SMILES | CC(O)CC1(C)CC(OC#N)CC(C)(C)C1 |
| InChI | InChI=1S/C13H23NO2/c1-10(15)5-13(4)7-11(16-9-14)6-12(2,3)8-13/h10-11,15H,5-8H2,1-4H3 |
| InChIKey | XTHKYMMJLCEAEH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|