About [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate
[3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate (PubChem CID 153361069) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate.
Molecular Properties
| Compound Name | [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate |
| PubChem CID | 153361069 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate |
| SMILES | CC(O)CC1(C)CC(OC#N)CC(C)(C)C1 |
| InChI | InChI=1S/C13H23NO2/c1-10(15)5-13(4)7-11(16-9-14)6-12(2,3)8-13/h10-11,15H,5-8H2,1-4H3 |
| InChIKey | XTHKYMMJLCEAEH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate?
The IUPAC name of [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate (CID 153361069) is [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate.
What is the SMILES notation for [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate?
The canonical SMILES for [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate is CC(O)CC1(C)CC(OC#N)CC(C)(C)C1.
What is the InChIKey of [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate?
The InChIKey is XTHKYMMJLCEAEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-10(15)5-13(4)7-11(16-9-14)6-12(2,3)8-13/h10-11,15H,5-8H2,1-4H3.
What are the key properties of [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate?
[3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate has a molecular weight of 225.33 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-hydroxypropyl)-3,5,5-trimethylcyclohexyl] cyanate is sourced from PubChem (CID 153361069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).