C10H18N2O4 — CID 139418643
(1,3,3-trimethyl-5-nitrosooxycyclohexyl)methyl nitrite (PubChem CID 139418643) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is (1,3,3-trimethyl-5-nitrosooxycyclohexyl)methyl nitrite.
| Compound Name | (1,3,3-trimethyl-5-nitrosooxycyclohexyl)methyl nitrite |
|---|---|
| PubChem CID | 139418643 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (1,3,3-trimethyl-5-nitrosooxycyclohexyl)methyl nitrite |
| SMILES | CC1(C)CC(ON=O)CC(C)(CON=O)C1 |
| InChI | InChI=1S/C10H18N2O4/c1-9(2)4-8(16-12-14)5-10(3,6-9)7-15-11-13/h8H,4-7H2,1-3H3 |
| InChIKey | VNVAALPYYPFQOM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|