C45H79N3O8 — CID 58322136
2-O-(3,3,5,5-tetramethylcyclohexyl) 1-O,3-O,4-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate (PubChem CID 58322136) has the molecular formula C45H79N3O8 and a molecular weight of 790.14 g/mol. Its IUPAC name is 2-O-(3,3,5,5-tetramethylcyclohexyl) 1-O,3-O,4-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate.
| Compound Name | 2-O-(3,3,5,5-tetramethylcyclohexyl) 1-O,3-O,4-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 58322136 |
| Molecular Formula | C45H79N3O8 |
| Molecular Weight | 790.14 g/mol |
| Exact Mass | 789.59 |
| IUPAC Name | 2-O-(3,3,5,5-tetramethylcyclohexyl) 1-O,3-O,4-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
| SMILES | CC1(C)CC(OC(=O)C(CC(=O)OC2CC(C)(C)NC(C)(C)C2)C(CC(=O)OC2CC(C)(C)NC(C)(C)C2)C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C45H79N3O8/c1-38(2)19-28(20-39(3,4)27-38)55-36(51)32(17-34(49)53-29-21-40(5,6)46-41(7,8)22-29)33(37(52)56-31-25-44(13,14)48-45(15,16)26-31)18-35(50)54-30-23-42(9,10)47-43(11,12)24-30/h28-33,46-48H,17-27H2,1-16H3 |
| InChIKey | JEABBZVBFMHHOS-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.14 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|