C56H98N6O10 — CID 91331242
1,10-bis(2,2,6,6-tetramethylpiperidin-4-yl)decane-1,10-dione;tetrapiperidin-4-yl butane-1,2,3,4-tetracarboxylate (PubChem CID 91331242) has the molecular formula C56H98N6O10 and a molecular weight of 1015.43 g/mol. Its IUPAC name is 1,10-bis(2,2,6,6-tetramethylpiperidin-4-yl)decane-1,10-dione;tetrapiperidin-4-yl butane-1,2,3,4-tetracarboxylate.
| Compound Name | 1,10-bis(2,2,6,6-tetramethylpiperidin-4-yl)decane-1,10-dione;tetrapiperidin-4-yl butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 91331242 |
| Molecular Formula | C56H98N6O10 |
| Molecular Weight | 1015.43 g/mol |
| Exact Mass | 1014.73 |
| IUPAC Name | 1,10-bis(2,2,6,6-tetramethylpiperidin-4-yl)decane-1,10-dione;tetrapiperidin-4-yl butane-1,2,3,4-tetracarboxylate |
| SMILES | CC1(C)CC(C(=O)CCCCCCCCC(=O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1.O=C(CC(C(=O)OC1CCNCC1)C(CC(=O)OC1CCNCC1)C(=O)OC1CCNCC1)OC1CCNCC1 |
| InChI | InChI=1S/C28H46N4O8.C28H52N2O2/c33-25(37-19-1-9-29-10-2-19)17-23(27(35)39-21-5-13-31-14-6-21)24(28(36)40-22-7-15-32-16-8-22)18-26(34)38-20-3-11-30-12-4-20;1-25(2)17-21(18-26(3,4)29-25)23(31)15-13-11-9-10-12-14-16-24(32)22-19-27(5,6)30-28(7,8)20-22/h19-24,29-32H,1-18H2;21-22,29-30H,9-20H2,1-8H3 |
| InChIKey | BCYXPKUFYXGSCJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 211.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 72 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.43 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|