C41H66N4O8 — CID 70371998
1-O,2-O,3-O-tris(2,2-dimethyl-6-methylidenepiperidin-4-yl) 4-O-(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate (PubChem CID 70371998) has the molecular formula C41H66N4O8 and a molecular weight of 743.00 g/mol. Its IUPAC name is 1-O,2-O,3-O-tris(2,2-dimethyl-6-methylidenepiperidin-4-yl) 4-O-(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate.
| Compound Name | 1-O,2-O,3-O-tris(2,2-dimethyl-6-methylidenepiperidin-4-yl) 4-O-(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 70371998 |
| Molecular Formula | C41H66N4O8 |
| Molecular Weight | 743.00 g/mol |
| Exact Mass | 742.49 |
| IUPAC Name | 1-O,2-O,3-O-tris(2,2-dimethyl-6-methylidenepiperidin-4-yl) 4-O-(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
| SMILES | C=C1CC(OC(=O)CC(C(=O)OC2CC(=C)NC(C)(C)C2)C(CC(=O)OC2CC(C)(C)NC(C)(C)C2)C(=O)OC2CC(=C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C41H66N4O8/c1-24-14-27(19-37(4,5)42-24)50-33(46)17-31(35(48)52-28-15-25(2)43-38(6,7)20-28)32(36(49)53-29-16-26(3)44-39(8,9)21-29)18-34(47)51-30-22-40(10,11)45-41(12,13)23-30/h27-32,42-45H,1-3,14-23H2,4-13H3 |
| InChIKey | QGYHKIJAQHDAAS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.00 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|