C45H80N4O8 — CID 58788050
tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) pentane-1,2,3,5-tetracarboxylate (PubChem CID 58788050) has the molecular formula C45H80N4O8 and a molecular weight of 805.15 g/mol. Its IUPAC name is tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) pentane-1,2,3,5-tetracarboxylate.
| Compound Name | tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) pentane-1,2,3,5-tetracarboxylate |
|---|---|
| PubChem CID | 58788050 |
| Molecular Formula | C45H80N4O8 |
| Molecular Weight | 805.15 g/mol |
| Exact Mass | 804.60 |
| IUPAC Name | tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) pentane-1,2,3,5-tetracarboxylate |
| SMILES | CC1(C)CC(OC(=O)CCC(C(=O)OC2CC(C)(C)NC(C)(C)C2)C(CC(=O)OC2CC(C)(C)NC(C)(C)C2)C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C45H80N4O8/c1-38(2)20-28(21-39(3,4)46-38)54-34(50)18-17-32(36(52)56-30-24-42(9,10)48-43(11,12)25-30)33(37(53)57-31-26-44(13,14)49-45(15,16)27-31)19-35(51)55-29-22-40(5,6)47-41(7,8)23-29/h28-33,46-49H,17-27H2,1-16H3 |
| InChIKey | DHPBRLCLEQYQEP-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.15 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|