C57H98N4O10 — CID 162124780
5-O-(3,3,5,5-tetramethylcyclohexyl) 1-O,2-O,3-O,4-O-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) cyclohexane-1,2,3,4,5-pentacarboxylate (PubChem CID 162124780) has the molecular formula C57H98N4O10 and a molecular weight of 999.43 g/mol. Its IUPAC name is 5-O-(3,3,5,5-tetramethylcyclohexyl) 1-O,2-O,3-O,4-O-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) cyclohexane-1,2,3,4,5-pentacarboxylate.
| Compound Name | 5-O-(3,3,5,5-tetramethylcyclohexyl) 1-O,2-O,3-O,4-O-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) cyclohexane-1,2,3,4,5-pentacarboxylate |
|---|---|
| PubChem CID | 162124780 |
| Molecular Formula | C57H98N4O10 |
| Molecular Weight | 999.43 g/mol |
| Exact Mass | 998.73 |
| IUPAC Name | 5-O-(3,3,5,5-tetramethylcyclohexyl) 1-O,2-O,3-O,4-O-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) cyclohexane-1,2,3,4,5-pentacarboxylate |
| SMILES | CC1(C)CC(OC(=O)C2CC(C(=O)OC3CC(C)(C)NC(C)(C)C3)C(C(=O)OC3CC(C)(C)NC(C)(C)C3)C(C(=O)OC3CC(C)(C)NC(C)(C)C3)C2C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C57H98N4O10/c1-48(2)22-33(23-49(3,4)32-48)67-43(62)38-21-39(44(63)68-34-24-50(5,6)58-51(7,8)25-34)41(46(65)70-36-28-54(13,14)60-55(15,16)29-36)42(47(66)71-37-30-56(17,18)61-57(19,20)31-37)40(38)45(64)69-35-26-52(9,10)59-53(11,12)27-35/h33-42,58-61H,21-32H2,1-20H3 |
| InChIKey | ZHWNNLOKMUDIMD-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.43 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|