C47H82N4O8 — CID 139317087
1-O,3-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-O,4-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) cyclopentane-1,2,3,4-tetracarboxylate (PubChem CID 139317087) has the molecular formula C47H82N4O8 and a molecular weight of 831.19 g/mol. Its IUPAC name is 1-O,3-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-O,4-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) cyclopentane-1,2,3,4-tetracarboxylate.
| Compound Name | 1-O,3-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-O,4-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) cyclopentane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 139317087 |
| Molecular Formula | C47H82N4O8 |
| Molecular Weight | 831.19 g/mol |
| Exact Mass | 830.61 |
| IUPAC Name | 1-O,3-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-O,4-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) cyclopentane-1,2,3,4-tetracarboxylate |
| SMILES | CN1C(C)(C)CC(OC(=O)C2CC(C(=O)OC3CC(C)(C)NC(C)(C)C3)C(C(=O)OC3CC(C)(C)N(C)C(C)(C)C3)C2C(=O)OC2CC(C)(C)NC(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C47H82N4O8/c1-40(2)20-28(21-41(3,4)48-40)56-36(52)32-19-33(37(53)57-30-24-44(9,10)50(17)45(11,12)25-30)34(38(54)58-29-22-42(5,6)49-43(7,8)23-29)35(32)39(55)59-31-26-46(13,14)51(18)47(15,16)27-31/h28-35,48-49H,19-27H2,1-18H3 |
| InChIKey | JWBFWGPUWCELIR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.19 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|