C12H21N3O2 — CID 54185038
(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-diazoacetate (PubChem CID 54185038) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-diazoacetate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-diazoacetate |
|---|---|
| PubChem CID | 54185038 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-diazoacetate |
| SMILES | CN1C(C)(C)CC(OC(=O)C=[N+]=[N-])CC1(C)C |
| InChI | InChI=1S/C12H21N3O2/c1-11(2)6-9(17-10(16)8-14-13)7-12(3,4)15(11)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | PEMZLWFYCFTNCW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|