C20H40N2O3P+ — CID 15358025
oxo-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]phosphanium (PubChem CID 15358025) has the molecular formula C20H40N2O3P+ and a molecular weight of 387.53 g/mol. Its IUPAC name is oxo-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]phosphanium.
| Compound Name | oxo-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]phosphanium |
|---|---|
| PubChem CID | 15358025 |
| Molecular Formula | C20H40N2O3P+ |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | oxo-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]phosphanium |
| SMILES | CN1C(C)(C)CC(O[P+](=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C20H40N2O3P/c1-17(2)11-15(12-18(3,4)21(17)9)24-26(23)25-16-13-19(5,6)22(10)20(7,8)14-16/h15-16H,11-14H2,1-10H3/q+1 |
| InChIKey | AVKSVONPILOJHI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|