C16H28N2O2 — CID 130180236
[3,3,5-trimethyl-5-[(2-methylbutanoylamino)methyl]cyclohexyl] cyanate (PubChem CID 130180236) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is [3,3,5-trimethyl-5-[(2-methylbutanoylamino)methyl]cyclohexyl] cyanate.
| Compound Name | [3,3,5-trimethyl-5-[(2-methylbutanoylamino)methyl]cyclohexyl] cyanate |
|---|---|
| PubChem CID | 130180236 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | [3,3,5-trimethyl-5-[(2-methylbutanoylamino)methyl]cyclohexyl] cyanate |
| SMILES | CCC(C)C(=O)NCC1(C)CC(OC#N)CC(C)(C)C1 |
| InChI | InChI=1S/C16H28N2O2/c1-6-12(2)14(19)18-10-16(5)8-13(20-11-17)7-15(3,4)9-16/h12-13H,6-10H2,1-5H3,(H,18,19) |
| InChIKey | NMXWZQANUAWLTC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|