C17H31NO5 — CID 130210916
methyl N-[[5-(1-ethylperoxyprop-2-enoxy)-1,3,3-trimethylcyclohexyl]methyl]carbamate (PubChem CID 130210916) has the molecular formula C17H31NO5 and a molecular weight of 329.44 g/mol. Its IUPAC name is methyl N-[[5-(1-ethylperoxyprop-2-enoxy)-1,3,3-trimethylcyclohexyl]methyl]carbamate.
| Compound Name | methyl N-[[5-(1-ethylperoxyprop-2-enoxy)-1,3,3-trimethylcyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 130210916 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | methyl N-[[5-(1-ethylperoxyprop-2-enoxy)-1,3,3-trimethylcyclohexyl]methyl]carbamate |
| SMILES | C=CC(OOCC)OC1CC(C)(C)CC(C)(CNC(=O)OC)C1 |
| InChI | InChI=1S/C17H31NO5/c1-7-14(23-21-8-2)22-13-9-16(3,4)11-17(5,10-13)12-18-15(19)20-6/h7,13-14H,1,8-12H2,2-6H3,(H,18,19) |
| InChIKey | KJXGCFVAUDVSDW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|