C15H26O — CID 134900829
(5R,8S)-2,6,10,10-tetramethyltricyclo[6.3.0.01,5]undecan-6-ol (PubChem CID 134900829) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (5R,8S)-2,6,10,10-tetramethyltricyclo[6.3.0.01,5]undecan-6-ol.
| Compound Name | (5R,8S)-2,6,10,10-tetramethyltricyclo[6.3.0.01,5]undecan-6-ol |
|---|---|
| PubChem CID | 134900829 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (5R,8S)-2,6,10,10-tetramethyltricyclo[6.3.0.01,5]undecan-6-ol |
| SMILES | CC1CC[C@H]2C(C)(O)C[C@@H]3CC(C)(C)CC132 |
| InChI | InChI=1S/C15H26O/c1-10-5-6-12-14(4,16)8-11-7-13(2,3)9-15(10,11)12/h10-12,16H,5-9H2,1-4H3/t10?,11-,12-,14?,15?/m0/s1 |
| InChIKey | RHLVTIMYILXEBJ-NFXIPBLASA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |