C15H26O2 — CID 163037310
(1R,4R,5R,6R,7R,10R)-7-(2-hydroxypropan-2-yl)-4,10-dimethyltricyclo[4.4.0.01,5]decan-4-ol (PubChem CID 163037310) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1R,4R,5R,6R,7R,10R)-7-(2-hydroxypropan-2-yl)-4,10-dimethyltricyclo[4.4.0.01,5]decan-4-ol.
| Compound Name | (1R,4R,5R,6R,7R,10R)-7-(2-hydroxypropan-2-yl)-4,10-dimethyltricyclo[4.4.0.01,5]decan-4-ol |
|---|---|
| PubChem CID | 163037310 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,4R,5R,6R,7R,10R)-7-(2-hydroxypropan-2-yl)-4,10-dimethyltricyclo[4.4.0.01,5]decan-4-ol |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)O)[C@@H]2[C@@H]3[C@@]21CC[C@@]3(C)O |
| InChI | InChI=1S/C15H26O2/c1-9-5-6-10(13(2,3)16)11-12-14(4,17)7-8-15(9,11)12/h9-12,16-17H,5-8H2,1-4H3/t9-,10-,11-,12+,14-,15-/m1/s1 |
| InChIKey | VJDDPDKNJHKWDF-OYFKMHTJSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |