C12H24O2 — CID 142654820
1-(1,2,2,3-tetramethylcyclohexyl)ethane-1,1-diol (PubChem CID 142654820) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-(1,2,2,3-tetramethylcyclohexyl)ethane-1,1-diol.
| Compound Name | 1-(1,2,2,3-tetramethylcyclohexyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 142654820 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 1-(1,2,2,3-tetramethylcyclohexyl)ethane-1,1-diol |
| SMILES | CC1CCCC(C)(C(C)(O)O)C1(C)C |
| InChI | InChI=1S/C12H24O2/c1-9-7-6-8-11(4,10(9,2)3)12(5,13)14/h9,13-14H,6-8H2,1-5H3 |
| InChIKey | XJQFFVYJVNKNTP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|