C25H50O4 — CID 101294802
2,2,3-trimethyl-1,1-bis(2-methylheptan-2-ylperoxy)cyclohexane (PubChem CID 101294802) has the molecular formula C25H50O4 and a molecular weight of 414.67 g/mol. Its IUPAC name is 2,2,3-trimethyl-1,1-bis(2-methylheptan-2-ylperoxy)cyclohexane.
| Compound Name | 2,2,3-trimethyl-1,1-bis(2-methylheptan-2-ylperoxy)cyclohexane |
|---|---|
| PubChem CID | 101294802 |
| Molecular Formula | C25H50O4 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.37 |
| IUPAC Name | 2,2,3-trimethyl-1,1-bis(2-methylheptan-2-ylperoxy)cyclohexane |
| SMILES | CCCCCC(C)(C)OOC1(OOC(C)(C)CCCCC)CCCC(C)C1(C)C |
| InChI | InChI=1S/C25H50O4/c1-10-12-14-18-22(4,5)26-28-25(20-16-17-21(3)24(25,8)9)29-27-23(6,7)19-15-13-11-2/h21H,10-20H2,1-9H3 |
| InChIKey | YBBKPOIIKUUPMW-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|