C21H42O4 — CID 141049093
1-[bis(2-methylpentan-2-ylperoxy)methyl]-1,3-dimethylcyclohexane (PubChem CID 141049093) has the molecular formula C21H42O4 and a molecular weight of 358.56 g/mol. Its IUPAC name is 1-[bis(2-methylpentan-2-ylperoxy)methyl]-1,3-dimethylcyclohexane.
| Compound Name | 1-[bis(2-methylpentan-2-ylperoxy)methyl]-1,3-dimethylcyclohexane |
|---|---|
| PubChem CID | 141049093 |
| Molecular Formula | C21H42O4 |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | 1-[bis(2-methylpentan-2-ylperoxy)methyl]-1,3-dimethylcyclohexane |
| SMILES | CCCC(C)(C)OOC(OOC(C)(C)CCC)C1(C)CCCC(C)C1 |
| InChI | InChI=1S/C21H42O4/c1-9-13-19(4,5)24-22-18(23-25-20(6,7)14-10-2)21(8)15-11-12-17(3)16-21/h17-18H,9-16H2,1-8H3 |
| InChIKey | MMDGPNALMYDZOH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|