C19H38O4 — CID 101294678
3-methyl-1,1-bis(3-methylpentan-3-ylperoxy)cyclohexane (PubChem CID 101294678) has the molecular formula C19H38O4 and a molecular weight of 330.51 g/mol. Its IUPAC name is 3-methyl-1,1-bis(3-methylpentan-3-ylperoxy)cyclohexane.
| Compound Name | 3-methyl-1,1-bis(3-methylpentan-3-ylperoxy)cyclohexane |
|---|---|
| PubChem CID | 101294678 |
| Molecular Formula | C19H38O4 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | 3-methyl-1,1-bis(3-methylpentan-3-ylperoxy)cyclohexane |
| SMILES | CCC(C)(CC)OOC1(OOC(C)(CC)CC)CCCC(C)C1 |
| InChI | InChI=1S/C19H38O4/c1-8-17(6,9-2)20-22-19(14-12-13-16(5)15-19)23-21-18(7,10-3)11-4/h16H,8-15H2,1-7H3 |
| InChIKey | UBWRUJMYZOUBTD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|