C11H22O4S2 — CID 121220475
1,1-bis(ethylsulfonyl)-3-methylcyclohexane (PubChem CID 121220475) has the molecular formula C11H22O4S2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1,1-bis(ethylsulfonyl)-3-methylcyclohexane.
| Compound Name | 1,1-bis(ethylsulfonyl)-3-methylcyclohexane |
|---|---|
| PubChem CID | 121220475 |
| Molecular Formula | C11H22O4S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1,1-bis(ethylsulfonyl)-3-methylcyclohexane |
| SMILES | CCS(=O)(=O)C1(S(=O)(=O)CC)CCCC(C)C1 |
| InChI | InChI=1S/C11H22O4S2/c1-4-16(12,13)11(17(14,15)5-2)8-6-7-10(3)9-11/h10H,4-9H2,1-3H3 |
| InChIKey | IYWPZDIDHWOOAV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |