About ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane
ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane (PubChem CID 145106735) has the molecular formula C12H25F
and a molecular weight of 188.33 g/mol. Its IUPAC name is ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane.
Molecular Properties
| Compound Name | ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane |
| PubChem CID | 145106735 |
| Molecular Formula | C12H25F |
| Molecular Weight | 188.33 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane |
| SMILES | CC.CCC[C@]1(F)CCC[C@@H](C)C1 |
| InChI | InChI=1S/C10H19F.C2H6/c1-3-6-10(11)7-4-5-9(2)8-10;1-2/h9H,3-8H2,1-2H3;1-2H3/t9-,10+;/m1./s1 |
| InChIKey | VZVWZZCWDJGPRF-UXQCFNEQSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane?
The IUPAC name of ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane (CID 145106735) is ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane.
What is the SMILES notation for ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane?
The canonical SMILES for ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane is CC.CCC[C@]1(F)CCC[C@@H](C)C1.
What is the InChIKey of ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane?
The InChIKey is VZVWZZCWDJGPRF-UXQCFNEQSA-N. The full InChI is InChI=1S/C10H19F.C2H6/c1-3-6-10(11)7-4-5-9(2)8-10;1-2/h9H,3-8H2,1-2H3;1-2H3/t9-,10+;/m1./s1.
What are the key properties of ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane?
ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane has a molecular weight of 188.33 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;trans-(1S,3R)-1-fluoro-3-methyl-1-propylcyclohexane is sourced from PubChem (CID 145106735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).