C9H16F2 — CID 54151474
1,3-difluoro-1-propylcyclohexane (PubChem CID 54151474) has the molecular formula C9H16F2 and a molecular weight of 162.22 g/mol. Its IUPAC name is 1,3-difluoro-1-propylcyclohexane.
| Compound Name | 1,3-difluoro-1-propylcyclohexane |
|---|---|
| PubChem CID | 54151474 |
| Molecular Formula | C9H16F2 |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,3-difluoro-1-propylcyclohexane |
| SMILES | CCCC1(F)CCCC(F)C1 |
| InChI | InChI=1S/C9H16F2/c1-2-5-9(11)6-3-4-8(10)7-9/h8H,2-7H2,1H3 |
| InChIKey | FKAYLPIOMACZBU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |