About 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane
1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane (PubChem CID 159605123) has the molecular formula C14H30F2O
and a molecular weight of 252.39 g/mol. Its IUPAC name is 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane.
Molecular Properties
| Compound Name | 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane |
| PubChem CID | 159605123 |
| Molecular Formula | C14H30F2O |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane |
| SMILES | C.C.CCCC1(F)CC1.CCCC1(F)COC1 |
| InChI | InChI=1S/C6H11FO.C6H11F.2CH4/c1-2-3-6(7)4-8-5-6;1-2-3-6(7)4-5-6;;/h2-5H2,1H3;2-5H2,1H3;2*1H4 |
| InChIKey | MLZFRFNGRNCQRI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane?
The IUPAC name of 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane (CID 159605123) is 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane.
What is the SMILES notation for 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane?
The canonical SMILES for 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane is C.C.CCCC1(F)CC1.CCCC1(F)COC1.
What is the InChIKey of 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane?
The InChIKey is MLZFRFNGRNCQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO.C6H11F.2CH4/c1-2-3-6(7)4-8-5-6;1-2-3-6(7)4-5-6;;/h2-5H2,1H3;2-5H2,1H3;2*1H4.
What are the key properties of 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane?
1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane has a molecular weight of 252.39 g/mol, XLogP of 5.09, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-1-propylcyclopropane;3-fluoro-3-propyloxetane;methane is sourced from PubChem (CID 159605123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).