About 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine
3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine (PubChem CID 112567440) has the molecular formula C9H15F4N
and a molecular weight of 213.22 g/mol. Its IUPAC name is 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine.
Analyze 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine?
The IUPAC name of 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine (CID 112567440) is 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine.
What is the SMILES notation for 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine?
The canonical SMILES for 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine is NC1CCCC(F)(CCC(F)(F)F)C1.
What is the InChIKey of 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine?
The InChIKey is UGQKRFTVLBOWEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F4N/c10-8(4-5-9(11,12)13)3-1-2-7(14)6-8/h7H,1-6,14H2.
What are the key properties of 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine?
3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine has a molecular weight of 213.22 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3-(3,3,3-trifluoropropyl)cyclohexan-1-amine is sourced from PubChem (CID 112567440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).