C11H21NO3S — CID 64552221
N-[1-(hydroxymethyl)-3-methylcyclohexyl]cyclopropanesulfonamide (PubChem CID 64552221) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)-3-methylcyclohexyl]cyclopropanesulfonamide.
| Compound Name | N-[1-(hydroxymethyl)-3-methylcyclohexyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 64552221 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-[1-(hydroxymethyl)-3-methylcyclohexyl]cyclopropanesulfonamide |
| SMILES | CC1CCCC(CO)(NS(=O)(=O)C2CC2)C1 |
| InChI | InChI=1S/C11H21NO3S/c1-9-3-2-6-11(7-9,8-13)12-16(14,15)10-4-5-10/h9-10,12-13H,2-8H2,1H3 |
| InChIKey | QPXYVVLIFRNVOL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |