C14H29NO3S — CID 106723632
[1-(2-tert-butylsulfonylethylamino)-3-methylcyclohexyl]methanol (PubChem CID 106723632) has the molecular formula C14H29NO3S and a molecular weight of 291.46 g/mol. Its IUPAC name is [1-(2-tert-butylsulfonylethylamino)-3-methylcyclohexyl]methanol.
| Compound Name | [1-(2-tert-butylsulfonylethylamino)-3-methylcyclohexyl]methanol |
|---|---|
| PubChem CID | 106723632 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | [1-(2-tert-butylsulfonylethylamino)-3-methylcyclohexyl]methanol |
| SMILES | CC1CCCC(CO)(NCCS(=O)(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H29NO3S/c1-12-6-5-7-14(10-12,11-16)15-8-9-19(17,18)13(2,3)4/h12,15-16H,5-11H2,1-4H3 |
| InChIKey | XLRAGVDRBJNZCD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |