C15H26O2 — CID 146292100
(1R,5R,7S,10R)-1,4,6,6,10-pentamethyltricyclo[5.3.0.02,5]decane-3,4-diol (PubChem CID 146292100) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1R,5R,7S,10R)-1,4,6,6,10-pentamethyltricyclo[5.3.0.02,5]decane-3,4-diol.
| Compound Name | (1R,5R,7S,10R)-1,4,6,6,10-pentamethyltricyclo[5.3.0.02,5]decane-3,4-diol |
|---|---|
| PubChem CID | 146292100 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,5R,7S,10R)-1,4,6,6,10-pentamethyltricyclo[5.3.0.02,5]decane-3,4-diol |
| SMILES | C[C@@H]1CC[C@H]2C(C)(C)[C@H]3C(C(O)C3(C)O)[C@]12C |
| InChI | InChI=1S/C15H26O2/c1-8-6-7-9-13(2,3)11-10(14(8,9)4)12(16)15(11,5)17/h8-12,16-17H,6-7H2,1-5H3/t8-,9+,10?,11-,12?,14-,15?/m1/s1 |
| InChIKey | YXBYDWZPZOSFMS-WWYDRJEISA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |