C9H16O2 — CID 143623982
(1R)-2,2,3-trimethylcyclopentane-1-carboxylic acid (PubChem CID 143623982) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (1R)-2,2,3-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | (1R)-2,2,3-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 143623982 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (1R)-2,2,3-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CC1CC[C@@H](C(=O)O)C1(C)C |
| InChI | InChI=1S/C9H16O2/c1-6-4-5-7(8(10)11)9(6,2)3/h6-7H,4-5H2,1-3H3,(H,10,11)/t6?,7-/m0/s1 |
| InChIKey | LYJVKLGSDVKQPY-MLWJPKLSSA-N |
| XLogP | 2.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |