C10H20N2O4S — CID 102627992
2,2,3-trimethyl-4-(sulfamoylamino)cyclohexane-1-carboxylic acid (PubChem CID 102627992) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2,2,3-trimethyl-4-(sulfamoylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 2,2,3-trimethyl-4-(sulfamoylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102627992 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2,2,3-trimethyl-4-(sulfamoylamino)cyclohexane-1-carboxylic acid |
| SMILES | CC1C(NS(N)(=O)=O)CCC(C(=O)O)C1(C)C |
| InChI | InChI=1S/C10H20N2O4S/c1-6-8(12-17(11,15)16)5-4-7(9(13)14)10(6,2)3/h6-8,12H,4-5H2,1-3H3,(H,13,14)(H2,11,15,16) |
| InChIKey | PSJXZBIEVBPRCZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |