C14H21NO3 — CID 107987004
4-(but-2-ynoylamino)-2,2,3-trimethylcyclohexane-1-carboxylic acid (PubChem CID 107987004) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-(but-2-ynoylamino)-2,2,3-trimethylcyclohexane-1-carboxylic acid.
| Compound Name | 4-(but-2-ynoylamino)-2,2,3-trimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 107987004 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 4-(but-2-ynoylamino)-2,2,3-trimethylcyclohexane-1-carboxylic acid |
| SMILES | CC#CC(=O)NC1CCC(C(=O)O)C(C)(C)C1C |
| InChI | InChI=1S/C14H21NO3/c1-5-6-12(16)15-11-8-7-10(13(17)18)14(3,4)9(11)2/h9-11H,7-8H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | PNGRIPXKCVBTOQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|