C15H23NO3 — CID 114028561
2,2,3-trimethyl-4-(pent-4-ynoylamino)cyclohexane-1-carboxylic acid (PubChem CID 114028561) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2,2,3-trimethyl-4-(pent-4-ynoylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 2,2,3-trimethyl-4-(pent-4-ynoylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114028561 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2,2,3-trimethyl-4-(pent-4-ynoylamino)cyclohexane-1-carboxylic acid |
| SMILES | C#CCCC(=O)NC1CCC(C(=O)O)C(C)(C)C1C |
| InChI | InChI=1S/C15H23NO3/c1-5-6-7-13(17)16-12-9-8-11(14(18)19)15(3,4)10(12)2/h1,10-12H,6-9H2,2-4H3,(H,16,17)(H,18,19) |
| InChIKey | ZTOCDQPXURKTAX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|