C19H36O2 — CID 145167018
(7aR)-6-ethyl-1,1,2,4,4,7a,8-heptamethyl-6,7,8,9,10,10a-hexahydro-2H-cyclopenta[f][1,3]dioxonine (PubChem CID 145167018) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is (7aR)-6-ethyl-1,1,2,4,4,7a,8-heptamethyl-6,7,8,9,10,10a-hexahydro-2H-cyclopenta[f][1,3]dioxonine.
| Compound Name | (7aR)-6-ethyl-1,1,2,4,4,7a,8-heptamethyl-6,7,8,9,10,10a-hexahydro-2H-cyclopenta[f][1,3]dioxonine |
|---|---|
| PubChem CID | 145167018 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | (7aR)-6-ethyl-1,1,2,4,4,7a,8-heptamethyl-6,7,8,9,10,10a-hexahydro-2H-cyclopenta[f][1,3]dioxonine |
| SMILES | CCC1C[C@]2(C)C(C)CCC2C(C)(C)C(C)OC(C)(C)O1 |
| InChI | InChI=1S/C19H36O2/c1-9-15-12-19(8)13(2)10-11-16(19)17(4,5)14(3)20-18(6,7)21-15/h13-16H,9-12H2,1-8H3/t13?,14?,15?,16?,19-/m1/s1 |
| InChIKey | LQRSIIMKRHKRTJ-FYFWZASSSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |