C17H28O2 — CID 129062490
(1R,3R,7S,8S,10S,13R)-5,5,9,9,13-pentamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane (PubChem CID 129062490) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (1R,3R,7S,8S,10S,13R)-5,5,9,9,13-pentamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane.
| Compound Name | (1R,3R,7S,8S,10S,13R)-5,5,9,9,13-pentamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
|---|---|
| PubChem CID | 129062490 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (1R,3R,7S,8S,10S,13R)-5,5,9,9,13-pentamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
| SMILES | C[C@@H]1CC[C@H]2C(C)(C)[C@@H]3C[C@@]12C[C@H]1OC(C)(C)O[C@@H]31 |
| InChI | InChI=1S/C17H28O2/c1-10-6-7-13-15(2,3)11-8-17(10,13)9-12-14(11)19-16(4,5)18-12/h10-14H,6-9H2,1-5H3/t10-,11-,12-,13+,14+,17-/m1/s1 |
| InChIKey | BOFCVQIHSIFWCJ-SGDAGTBVSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |