C20H32O2 — CID 155617527
7,9,9,13-tetramethyl-5-(2-methylprop-1-enyl)-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane (PubChem CID 155617527) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 7,9,9,13-tetramethyl-5-(2-methylprop-1-enyl)-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane.
| Compound Name | 7,9,9,13-tetramethyl-5-(2-methylprop-1-enyl)-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
|---|---|
| PubChem CID | 155617527 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 7,9,9,13-tetramethyl-5-(2-methylprop-1-enyl)-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
| SMILES | CC(C)=CC1OC2CC34CC(C(C)(C)C3CCC4C)C2(C)O1 |
| InChI | InChI=1S/C20H32O2/c1-12(2)9-17-21-16-11-20-10-15(19(16,6)22-17)18(4,5)14(20)8-7-13(20)3/h9,13-17H,7-8,10-11H2,1-6H3 |
| InChIKey | KWVZDMPNYOJBEC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|