C21H34O3 — CID 155727827
(1R,3S,7R,8R,10S,13R)-5,7,9,9,13-pentamethyl-5-(prop-1-enoxymethyl)-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane (PubChem CID 155727827) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (1R,3S,7R,8R,10S,13R)-5,7,9,9,13-pentamethyl-5-(prop-1-enoxymethyl)-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane.
| Compound Name | (1R,3S,7R,8R,10S,13R)-5,7,9,9,13-pentamethyl-5-(prop-1-enoxymethyl)-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
|---|---|
| PubChem CID | 155727827 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (1R,3S,7R,8R,10S,13R)-5,7,9,9,13-pentamethyl-5-(prop-1-enoxymethyl)-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
| SMILES | CC=COCC1(C)O[C@H]2C[C@@]34C[C@H](C(C)(C)[C@@H]3CC[C@H]4C)[C@@]2(C)O1 |
| InChI | InChI=1S/C21H34O3/c1-7-10-22-13-19(5)23-17-12-21-11-16(20(17,6)24-19)18(3,4)15(21)9-8-14(21)2/h7,10,14-17H,8-9,11-13H2,1-6H3/t14-,15+,16-,17+,19?,20-,21-/m1/s1 |
| InChIKey | BAOUTSMLEVYJCO-UDTQYDSTSA-N |
| XLogP | 4.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|