C17H24O9 — CID 57342062
(1S,2R,4R,5R,6S,7R,8R,11R)-4,5,7-trihydroxy-11-(methoxymethoxy)-2,7-dimethylspiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-2',10-dione (PubChem CID 57342062) has the molecular formula C17H24O9 and a molecular weight of 372.37 g/mol. Its IUPAC name is (1S,2R,4R,5R,6S,7R,8R,11R)-4,5,7-trihydroxy-11-(methoxymethoxy)-2,7-dimethylspiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-2',10-dione.
| Compound Name | (1S,2R,4R,5R,6S,7R,8R,11R)-4,5,7-trihydroxy-11-(methoxymethoxy)-2,7-dimethylspiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-2',10-dione |
|---|---|
| PubChem CID | 57342062 |
| Molecular Formula | C17H24O9 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (1S,2R,4R,5R,6S,7R,8R,11R)-4,5,7-trihydroxy-11-(methoxymethoxy)-2,7-dimethylspiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-2',10-dione |
| SMILES | COCO[C@H]1C(=O)O[C@@H]2C[C@]13[C@H](C)C[C@@H](O)[C@]3(O)[C@]1(COC1=O)[C@@]2(C)O |
| InChI | InChI=1S/C17H24O9/c1-8-4-9(18)17(22)15(8)5-10(26-12(19)11(15)25-7-23-3)14(2,21)16(17)6-24-13(16)20/h8-11,18,21-22H,4-7H2,1-3H3/t8-,9-,10-,11+,14+,15+,16+,17-/m1/s1 |
| InChIKey | GYWQRILWORLVPZ-KPPGPJPXSA-N |
| XLogP | -1.28 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|