C25H32O6 — CID 134945806
(2R,6R,7R,8R,11R)-6-ethenyl-7-hydroxy-11-(methoxymethoxy)-2,7-dimethyl-6-(phenylmethoxymethyl)-9-oxatricyclo[6.3.1.01,5]dodec-4-en-10-one (PubChem CID 134945806) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is (2R,6R,7R,8R,11R)-6-ethenyl-7-hydroxy-11-(methoxymethoxy)-2,7-dimethyl-6-(phenylmethoxymethyl)-9-oxatricyclo[6.3.1.01,5]dodec-4-en-10-one.
| Compound Name | (2R,6R,7R,8R,11R)-6-ethenyl-7-hydroxy-11-(methoxymethoxy)-2,7-dimethyl-6-(phenylmethoxymethyl)-9-oxatricyclo[6.3.1.01,5]dodec-4-en-10-one |
|---|---|
| PubChem CID | 134945806 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (2R,6R,7R,8R,11R)-6-ethenyl-7-hydroxy-11-(methoxymethoxy)-2,7-dimethyl-6-(phenylmethoxymethyl)-9-oxatricyclo[6.3.1.01,5]dodec-4-en-10-one |
| SMILES | C=C[C@]1(COCc2ccccc2)C2=CC[C@@H](C)C23C[C@@H](OC(=O)[C@@H]3OCOC)[C@]1(C)O |
| InChI | InChI=1S/C25H32O6/c1-5-24(15-29-14-18-9-7-6-8-10-18)19-12-11-17(2)25(19)13-20(23(24,3)27)31-22(26)21(25)30-16-28-4/h5-10,12,17,20-21,27H,1,11,13-16H2,2-4H3/t17-,20-,21+,23+,24+,25?/m1/s1 |
| InChIKey | WCHCHIBQPKGEKS-MMYJWLGPSA-N |
| XLogP | 3.40 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|