C26H34O10 — CID 177385761
methyl (2S)-2-[(1R,2S,4S,6S,7S,11R,12R)-11-(methoxymethoxy)-7-(methoxymethyl)-2,6-dimethyl-8-oxo-3,9,13-trioxatetracyclo[8.2.1.02,4.06,12]tridecan-1-yl]-2-phenylmethoxyacetate (PubChem CID 177385761) has the molecular formula C26H34O10 and a molecular weight of 506.55 g/mol. Its IUPAC name is methyl (2S)-2-[(1R,2S,4S,6S,7S,11R,12R)-11-(methoxymethoxy)-7-(methoxymethyl)-2,6-dimethyl-8-oxo-3,9,13-trioxatetracyclo[8.2.1.02,4.06,12]tridecan-1-yl]-2-phenylmethoxyacetate.
| Compound Name | methyl (2S)-2-[(1R,2S,4S,6S,7S,11R,12R)-11-(methoxymethoxy)-7-(methoxymethyl)-2,6-dimethyl-8-oxo-3,9,13-trioxatetracyclo[8.2.1.02,4.06,12]tridecan-1-yl]-2-phenylmethoxyacetate |
|---|---|
| PubChem CID | 177385761 |
| Molecular Formula | C26H34O10 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | methyl (2S)-2-[(1R,2S,4S,6S,7S,11R,12R)-11-(methoxymethoxy)-7-(methoxymethyl)-2,6-dimethyl-8-oxo-3,9,13-trioxatetracyclo[8.2.1.02,4.06,12]tridecan-1-yl]-2-phenylmethoxyacetate |
| SMILES | COCO[C@H]1C2OC(=O)[C@H](COC)[C@@]3(C)C[C@@H]4O[C@]4(C)[C@@]([C@H](OCc4ccccc4)C(=O)OC)(O2)[C@@H]13 |
| InChI | InChI=1S/C26H34O10/c1-24-11-17-25(2,35-17)26(20(22(28)31-5)32-12-15-9-7-6-8-10-15)19(24)18(33-14-30-4)23(36-26)34-21(27)16(24)13-29-3/h6-10,16-20,23H,11-14H2,1-5H3/t16-,17-,18+,19-,20+,23?,24+,25-,26+/m0/s1 |
| InChIKey | LTEJAHRABVKNTI-XUFRLYKRSA-N |
| XLogP | 1.83 |
| TPSA | 111.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|