C27H33NO9 — CID 24807845
(3aS,4R,5R,6R,7S,7aS)-6-(methoxymethoxy)-2,2-dimethyl-4-nitro-7-phenylmethoxy-7-(phenylmethoxymethyl)-4,5,6,7a-tetrahydro-3aH-1,3-benzodioxole-5-carbaldehyde (PubChem CID 24807845) has the molecular formula C27H33NO9 and a molecular weight of 515.56 g/mol. Its IUPAC name is (3aS,4R,5R,6R,7S,7aS)-6-(methoxymethoxy)-2,2-dimethyl-4-nitro-7-phenylmethoxy-7-(phenylmethoxymethyl)-4,5,6,7a-tetrahydro-3aH-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | (3aS,4R,5R,6R,7S,7aS)-6-(methoxymethoxy)-2,2-dimethyl-4-nitro-7-phenylmethoxy-7-(phenylmethoxymethyl)-4,5,6,7a-tetrahydro-3aH-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 24807845 |
| Molecular Formula | C27H33NO9 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | (3aS,4R,5R,6R,7S,7aS)-6-(methoxymethoxy)-2,2-dimethyl-4-nitro-7-phenylmethoxy-7-(phenylmethoxymethyl)-4,5,6,7a-tetrahydro-3aH-1,3-benzodioxole-5-carbaldehyde |
| SMILES | COCO[C@@H]1[C@H](C=O)[C@@H]([N+](=O)[O-])[C@@H]2OC(C)(C)O[C@@H]2[C@@]1(COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C27H33NO9/c1-26(2)36-23-22(28(30)31)21(14-29)24(34-18-32-3)27(25(23)37-26,35-16-20-12-8-5-9-13-20)17-33-15-19-10-6-4-7-11-19/h4-14,21-25H,15-18H2,1-3H3/t21-,22-,23+,24-,25+,27+/m1/s1 |
| InChIKey | ZQUFZKSVMZKMCY-GKWROVLDSA-N |
| XLogP | 3.14 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|