C14H22O5 — CID 10778450
(1R,3R,4S,6S)-3-(methoxymethoxy)-4,6,8,8-tetramethyl-7,9-dioxatricyclo[4.4.0.01,4]decan-10-one (PubChem CID 10778450) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is (1R,3R,4S,6S)-3-(methoxymethoxy)-4,6,8,8-tetramethyl-7,9-dioxatricyclo[4.4.0.01,4]decan-10-one.
| Compound Name | (1R,3R,4S,6S)-3-(methoxymethoxy)-4,6,8,8-tetramethyl-7,9-dioxatricyclo[4.4.0.01,4]decan-10-one |
|---|---|
| PubChem CID | 10778450 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (1R,3R,4S,6S)-3-(methoxymethoxy)-4,6,8,8-tetramethyl-7,9-dioxatricyclo[4.4.0.01,4]decan-10-one |
| SMILES | COCO[C@@H]1C[C@]23C(=O)OC(C)(C)O[C@@]2(C)C[C@]13C |
| InChI | InChI=1S/C14H22O5/c1-11(2)18-10(15)14-6-9(17-8-16-5)12(14,3)7-13(14,4)19-11/h9H,6-8H2,1-5H3/t9-,12-,13+,14-/m1/s1 |
| InChIKey | WMHINIHIULJGRE-WBMYTEFPSA-N |
| XLogP | 1.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|