C16H26O6S — CID 10360271
[(1R,2S,6S,9R)-2-(methoxymethoxy)-9-methyl-8-oxo-10-tricyclo[7.2.1.01,6]dodecanyl] methanesulfonate (PubChem CID 10360271) has the molecular formula C16H26O6S and a molecular weight of 346.45 g/mol. Its IUPAC name is [(1R,2S,6S,9R)-2-(methoxymethoxy)-9-methyl-8-oxo-10-tricyclo[7.2.1.01,6]dodecanyl] methanesulfonate.
| Compound Name | [(1R,2S,6S,9R)-2-(methoxymethoxy)-9-methyl-8-oxo-10-tricyclo[7.2.1.01,6]dodecanyl] methanesulfonate |
|---|---|
| PubChem CID | 10360271 |
| Molecular Formula | C16H26O6S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [(1R,2S,6S,9R)-2-(methoxymethoxy)-9-methyl-8-oxo-10-tricyclo[7.2.1.01,6]dodecanyl] methanesulfonate |
| SMILES | COCO[C@H]1CCC[C@H]2CC(=O)[C@]3(C)C[C@@]21CC3OS(C)(=O)=O |
| InChI | InChI=1S/C16H26O6S/c1-15-9-16(8-14(15)22-23(3,18)19)11(7-12(15)17)5-4-6-13(16)21-10-20-2/h11,13-14H,4-10H2,1-3H3/t11-,13-,14?,15-,16-/m0/s1 |
| InChIKey | JHBVQQLJYAZTMV-LENQNHOGSA-N |
| XLogP | 1.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|