C11H20O6S2 — CID 101349431
[(4S,9S)-4-methylsulfonyloxyspiro[4.4]nonan-9-yl] methanesulfonate (PubChem CID 101349431) has the molecular formula C11H20O6S2 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(4S,9S)-4-methylsulfonyloxyspiro[4.4]nonan-9-yl] methanesulfonate.
| Compound Name | [(4S,9S)-4-methylsulfonyloxyspiro[4.4]nonan-9-yl] methanesulfonate |
|---|---|
| PubChem CID | 101349431 |
| Molecular Formula | C11H20O6S2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | [(4S,9S)-4-methylsulfonyloxyspiro[4.4]nonan-9-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1CCCC12CCC[C@@H]2OS(C)(=O)=O |
| InChI | InChI=1S/C11H20O6S2/c1-18(12,13)16-9-5-3-7-11(9)8-4-6-10(11)17-19(2,14)15/h9-10H,3-8H2,1-2H3/t9-,10-,11?/m0/s1 |
| InChIKey | BVYNKWHVPDRAIG-QRHSGQBVSA-N |
| XLogP | 1.03 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|