C12H20O4S — CID 135020334
[(1S,6S,8aS)-6-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl] methanesulfonate (PubChem CID 135020334) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is [(1S,6S,8aS)-6-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl] methanesulfonate.
| Compound Name | [(1S,6S,8aS)-6-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 135020334 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | [(1S,6S,8aS)-6-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl] methanesulfonate |
| SMILES | C[C@]12CC[C@H](O)CC1=CCC[C@@H]2OS(C)(=O)=O |
| InChI | InChI=1S/C12H20O4S/c1-12-7-6-10(13)8-9(12)4-3-5-11(12)16-17(2,14)15/h4,10-11,13H,3,5-8H2,1-2H3/t10-,11-,12-/m0/s1 |
| InChIKey | AWJIZEVLAWVGBW-SRVKXCTJSA-N |
| XLogP | 1.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|