C7H14O4S — CID 88644147
[(1S,3S)-3-hydroxycyclohexyl] methanesulfonate (PubChem CID 88644147) has the molecular formula C7H14O4S and a molecular weight of 194.25 g/mol. Its IUPAC name is [(1S,3S)-3-hydroxycyclohexyl] methanesulfonate.
| Compound Name | [(1S,3S)-3-hydroxycyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 88644147 |
| Molecular Formula | C7H14O4S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | [(1S,3S)-3-hydroxycyclohexyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C7H14O4S/c1-12(9,10)11-7-4-2-3-6(8)5-7/h6-8H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | PBMZWBSAXZWCQT-BQBZGAKWSA-N |
| XLogP | 0.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|