About (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate
(3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate (PubChem CID 59602439) has the molecular formula C11H17F3O3
and a molecular weight of 254.25 g/mol. Its IUPAC name is (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate.
Analyze (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate?
The IUPAC name of (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate (CID 59602439) is (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate.
What is the SMILES notation for (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate?
The canonical SMILES for (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate is CC(C)(C(=O)OC1CCCC(O)C1)C(F)(F)F.
What is the InChIKey of (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate?
The InChIKey is CBOHUYWATMQBER-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3O3/c1-10(2,11(12,13)14)9(16)17-8-5-3-4-7(15)6-8/h7-8,15H,3-6H2,1-2H3.
What are the key properties of (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate?
(3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate has a molecular weight of 254.25 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxycyclohexyl) 3,3,3-trifluoro-2,2-dimethylpropanoate is sourced from PubChem (CID 59602439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).