C12H22O4 — CID 58280201
tert-butyl 2-[(1R,3S)-3-hydroxycyclohexyl]oxyacetate (PubChem CID 58280201) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is tert-butyl 2-[(1R,3S)-3-hydroxycyclohexyl]oxyacetate.
| Compound Name | tert-butyl 2-[(1R,3S)-3-hydroxycyclohexyl]oxyacetate |
|---|---|
| PubChem CID | 58280201 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | tert-butyl 2-[(1R,3S)-3-hydroxycyclohexyl]oxyacetate |
| SMILES | CC(C)(C)OC(=O)CO[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C12H22O4/c1-12(2,3)16-11(14)8-15-10-6-4-5-9(13)7-10/h9-10,13H,4-8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | CSRMAOCBRDJCAZ-VHSXEESVSA-N |
| XLogP | 1.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |