C10H15F3O6S — CID 89115496
(3-hydroxycyclohexyl) 3,3,3-trifluoro-2-methyl-2-(trioxidanylsulfanyl)propanoate (PubChem CID 89115496) has the molecular formula C10H15F3O6S and a molecular weight of 320.29 g/mol. Its IUPAC name is (3-hydroxycyclohexyl) 3,3,3-trifluoro-2-methyl-2-(trioxidanylsulfanyl)propanoate.
| Compound Name | (3-hydroxycyclohexyl) 3,3,3-trifluoro-2-methyl-2-(trioxidanylsulfanyl)propanoate |
|---|---|
| PubChem CID | 89115496 |
| Molecular Formula | C10H15F3O6S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (3-hydroxycyclohexyl) 3,3,3-trifluoro-2-methyl-2-(trioxidanylsulfanyl)propanoate |
| SMILES | CC(SOOO)(C(=O)OC1CCCC(O)C1)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O6S/c1-9(10(11,12)13,20-19-18-16)8(15)17-7-4-2-3-6(14)5-7/h6-7,14,16H,2-5H2,1H3 |
| InChIKey | SSZLHSXKAGEQSE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|