About [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate
[(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate (PubChem CID 11011167) has the molecular formula C11H19N3O3S
and a molecular weight of 273.36 g/mol. Its IUPAC name is [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate.
Molecular Properties
| Compound Name | [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate |
| PubChem CID | 11011167 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(N=[N+]=[N-])[C@@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H19N3O3S/c1-8(2)9-5-6-11(3,13-14-12)10(7-9)17-18(4,15)16/h9-10H,1,5-7H2,2-4H3/t9-,10+,11+/m1/s1 |
| InChIKey | ONUGLKADSOEVHT-VWYCJHECSA-N |
| XLogP | 2.78 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate?
The IUPAC name of [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate (CID 11011167) is [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate.
What is the SMILES notation for [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate?
The canonical SMILES for [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate is C=C(C)[C@@H]1CC[C@](C)(N=[N+]=[N-])[C@@H](OS(C)(=O)=O)C1.
What is the InChIKey of [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate?
The InChIKey is ONUGLKADSOEVHT-VWYCJHECSA-N. The full InChI is InChI=1S/C11H19N3O3S/c1-8(2)9-5-6-11(3,13-14-12)10(7-9)17-18(4,15)16/h9-10H,1,5-7H2,2-4H3/t9-,10+,11+/m1/s1.
What are the key properties of [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate?
[(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate has a molecular weight of 273.36 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S,5R)-2-azido-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate is sourced from PubChem (CID 11011167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).