C10H18N4 — CID 86078004
2-azido-2-methyl-5-prop-1-en-2-ylcyclohexan-1-amine (PubChem CID 86078004) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-azido-2-methyl-5-prop-1-en-2-ylcyclohexan-1-amine.
| Compound Name | 2-azido-2-methyl-5-prop-1-en-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 86078004 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2-azido-2-methyl-5-prop-1-en-2-ylcyclohexan-1-amine |
| SMILES | C=C(C)C1CCC(C)(N=[N+]=[N-])C(N)C1 |
| InChI | InChI=1S/C10H18N4/c1-7(2)8-4-5-10(3,13-14-12)9(11)6-8/h8-9H,1,4-6,11H2,2-3H3 |
| InChIKey | KWYDYKXVZBHFKV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|